Molecular Structure:
CCD No.:CCD04235480
ZERENEX E/7088558
Formula:C24 H25 N5 O S
MolWeight:431.561
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/7088558 |
| English Synonyms： | ZERENEX E/7088558 |
| MDL Number.： | MFCD18482348 |
| H bond acceptor： | 6 |
| H bond donor： | 1 |
| Smile： | Cc1ccc(cc1)COc2ccc(cc2)CNCCSc3nnnn3c4ccccc4 |
| InChi： | InChI=1S/C24H25N5OS/c1-19-7-9-21(10-8-19)18-30-23-13-11-20(12-14-23)17-25-15-16-31-24-26-27-28-29(24)22-5-3-2-4-6-22/h2-14,25H,15-18H2,1H3 |
| InChiKey： | InChIKey=VLNXXSSEZAUZKK-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
