Molecular Structure:
CCD No.:CCD04235483
ZERENEX E/7088561
Formula:C22 H28 Br N O2
MolWeight:418.372
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/7088561 |
| English Synonyms： | ZERENEX E/7088561 |
| MDL Number.： | MFCD18482351 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | Cc1ccc(cc1)COc2c(cc(cc2Br)CNC3CCCCC3)OC |
| InChi： | InChI=1S/C22H28BrNO2/c1-16-8-10-17(11-9-16)15-26-22-20(23)12-18(13-21(22)25-2)14-24-19-6-4-3-5-7-19/h8-13,19,24H,3-7,14-15H2,1-2H3 |
| InChiKey： | InChIKey=BCGDSWNWIWCROO-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
