* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX E/7088567 |
| English Synonyms: | ZERENEX E/7088567 |
| MDL Number.: | MFCD18482353 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | Cc1ccc(cc1)COc2c(cc(cc2Br)CNCCO)OC |
| InChi: | InChI=1S/C18H22BrNO3/c1-13-3-5-14(6-4-13)12-23-18-16(19)9-15(10-17(18)22-2)11-20-7-8-21/h3-6,9-10,20-21H,7-8,11-12H2,1-2H3 |
| InChiKey: | InChIKey=JBDNRPAEXPRKPF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.