* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX E/7088582 |
English Synonyms: | ZERENEX E/7088582 |
MDL Number.: | MFCD18482367 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCCNCc1cc(c(c(c1)Br)OCc2ccc(cc2)C)OC |
InChi: | InChI=1S/C19H24BrNO2/c1-4-9-21-12-16-10-17(20)19(18(11-16)22-3)23-13-15-7-5-14(2)6-8-15/h5-8,10-11,21H,4,9,12-13H2,1-3H3 |
InChiKey: | InChIKey=IXGKXJXTNALTSZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.