* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX E/7088834 |
English Synonyms: | ZERENEX E/7088834 |
MDL Number.: | MFCD18482569 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cc1ccc(cc1)COc2cccc(c2)CNCCc3ccc(c(c3)OC)OC |
InChi: | InChI=1S/C25H29NO3/c1-19-7-9-21(10-8-19)18-29-23-6-4-5-22(15-23)17-26-14-13-20-11-12-24(27-2)25(16-20)28-3/h4-12,15-16,26H,13-14,17-18H2,1-3H3 |
InChiKey: | InChIKey=KUUUEAZBTIZXIL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.