Molecular Structure:
CCD No.:CCD04235708
ZERENEX E/7088845
Formula:C20 H28 N2 O
MolWeight:312.454
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/7088845 |
| English Synonyms： | ZERENEX E/7088845 |
| MDL Number.： | MFCD18482576 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | Cc1ccc(cc1)COc2cccc(c2)CNCCCN(C)C |
| InChi： | InChI=1S/C20H28N2O/c1-17-8-10-18(11-9-17)16-23-20-7-4-6-19(14-20)15-21-12-5-13-22(2)3/h4,6-11,14,21H,5,12-13,15-16H2,1-3H3 |
| InChiKey： | InChIKey=RQPZSXSBKSEWGR-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
