* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX E/7088860 |
English Synonyms: | ZERENEX E/7088860 |
MDL Number.: | MFCD18482587 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | Cc1ccc(cc1)COc2cccc(c2)CNC3CCCCCCC3 |
InChi: | InChI=1S/C23H31NO/c1-19-12-14-20(15-13-19)18-25-23-11-7-8-21(16-23)17-24-22-9-5-3-2-4-6-10-22/h7-8,11-16,22,24H,2-6,9-10,17-18H2,1H3 |
InChiKey: | InChIKey=OOYHCXJRBHHUNU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.