* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX E/7089151 |
English Synonyms: | ZERENEX E/7089151 |
MDL Number.: | MFCD18482820 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CN(C)CCCNCc1ccc(o1)c2ccccc2Cl |
InChi: | InChI=1S/C16H21ClN2O/c1-19(2)11-5-10-18-12-13-8-9-16(20-13)14-6-3-4-7-15(14)17/h3-4,6-9,18H,5,10-12H2,1-2H3 |
InChiKey: | InChIKey=KUCHQUZUHSZMSH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.