Molecular Structure:
CCD No.:CCD04235960
ZERENEX E/7089166
Formula:C19 H24 Cl N O
MolWeight:317.858
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/7089166 |
| English Synonyms： | ZERENEX E/7089166 |
| MDL Number.： | MFCD18482828 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | c1ccc(c(c1)c2ccc(o2)CNC3CCCCCCC3)Cl |
| InChi： | InChI=1S/C19H24ClNO/c20-18-11-7-6-10-17(18)19-13-12-16(22-19)14-21-15-8-4-2-1-3-5-9-15/h6-7,10-13,15,21H,1-5,8-9,14H2 |
| InChiKey： | InChIKey=VASIEPJTHODOQE-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
