Molecular Structure:
CCD No.:CCD04236150
ZERENEX E/7089434
Formula:C22 H29 Cl2 N O
MolWeight:394.383
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/7089434 |
| English Synonyms： | ZERENEX E/7089434 |
| MDL Number.： | MFCD18483018 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | CCCCCCCCNCc1cc(c(c(c1)Cl)OCc2ccccc2)Cl |
| InChi： | InChI=1S/C22H29Cl2NO/c1-2-3-4-5-6-10-13-25-16-19-14-20(23)22(21(24)15-19)26-17-18-11-8-7-9-12-18/h7-9,11-12,14-15,25H,2-6,10,13,16-17H2,1H3 |
| InChiKey： | InChIKey=CLWCYGCPEVSYHY-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
