Molecular Structure:
CCD No.:CCD04236152
ZERENEX E/7089436
Formula:C22 H27 Cl2 N O
MolWeight:392.367
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/7089436 |
| English Synonyms： | ZERENEX E/7089436 |
| MDL Number.： | MFCD18483020 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | c1ccc(cc1)COc2c(cc(cc2Cl)CNC3CCCCCCC3)Cl |
| InChi： | InChI=1S/C22H27Cl2NO/c23-20-13-18(15-25-19-11-7-2-1-3-8-12-19)14-21(24)22(20)26-16-17-9-5-4-6-10-17/h4-6,9-10,13-14,19,25H,1-3,7-8,11-12,15-16H2 |
| InChiKey： | InChIKey=BHLLTIJFRIYCIW-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
