Molecular Structure:
CCD No.:CCD04236159
ZERENEX E/7089445
Formula:C25 H23 Cl N6 S
MolWeight:475.018
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/7089445 |
| English Synonyms： | ZERENEX E/7089445 |
| MDL Number.： | MFCD18483027 |
| H bond acceptor： | 6 |
| H bond donor： | 1 |
| Smile： | c1ccc(cc1)n2c(nnn2)SCCNCc3cn(c4c3cccc4)Cc5ccccc5Cl |
| InChi： | InChI=1S/C25H23ClN6S/c26-23-12-6-4-8-19(23)17-31-18-20(22-11-5-7-13-24(22)31)16-27-14-15-33-25-28-29-30-32(25)21-9-2-1-3-10-21/h1-13,18,27H,14-17H2 |
| InChiKey： | InChIKey=QVHLEMFHWJFOGV-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
