Molecular Structure:
CCD No.:CCD04236183
ZERENEX E/8034056
Formula:C16 H11 N O6
MolWeight:313.264
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/8034056 |
| English Synonyms： | ZERENEX E/8034056 |
| MDL Number.： | MFCD18483051 |
| H bond acceptor： | 7 |
| H bond donor： | 0 |
| Smile： | c1cc(ccc1C(=O)OC2C(=O)CCC2=O)N3C(=O)C=CC3=O |
| InChi： | InChI=1S/C16H11NO6/c18-11-5-6-12(19)15(11)23-16(22)9-1-3-10(4-2-9)17-13(20)7-8-14(17)21/h1-4,7-8,15H,5-6H2 |
| InChiKey： | InChIKey=GDFSLGDZISTDOJ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
