* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ATTERCOP-CHM AT700410 |
| CAS: | 53-41-8 |
| English Synonyms: | ATTERCOP-CHM AT700410 |
| MDL Number.: | MFCD18533369 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | C[C@]12CC[C@H](C[C@@H]1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CCC4=O)C)O |
| InChi: | InChI=1S/C19H30O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h12-16,20H,3-11H2,1-2H3/t12-,13+,14-,15-,16-,18-,19-/m0/s1 |
| InChiKey: | InChIKey=QGXBDMJGAMFCBF-HLUDHZFRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.