* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-[(2-AMINO-4-METHYL-1,3-THIAZOL-5-YL)CARBONYL]-8-AZABICYCLO[3.2.1]OCTAN-3-OL |
English Synonyms: | 8-[(2-AMINO-4-METHYL-1,3-THIAZOL-5-YL)CARBONYL]-8-AZABICYCLO[3.2.1]OCTAN-3-OL |
MDL Number.: | MFCD18617722 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | Cc1c(sc(n1)N)C(=O)N2C3CCC2CC(C3)O |
InChi: | InChI=1S/C12H17N3O2S/c1-6-10(18-12(13)14-6)11(17)15-7-2-3-8(15)5-9(16)4-7/h7-9,16H,2-5H2,1H3,(H2,13,14) |
InChiKey: | InChIKey=IVFMIRFTUGXRBU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.