* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-[3-(METHYLAMINO)AZETIDIN-1-YL]-7-OXA-10,12-DIAZATRICYCLO[6.4.0.0(2,6)]DODECA-1(12),2(6),8,10-TETRAEN-11-AMINE |
| CAS: | 1148115-99-4 |
| English Synonyms: | 9-[3-(METHYLAMINO)AZETIDIN-1-YL]-7-OXA-10,12-DIAZATRICYCLO[6.4.0.0(2,6)]DODECA-1(12),2(6),8,10-TETRAEN-11-AMINE |
| MDL Number.: | MFCD18633234 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CNC1CN(C1)c2c3c(c4c(o3)CCC4)nc(n2)N |
| InChi: | InChI=1S/C13H17N5O/c1-15-7-5-18(6-7)12-11-10(16-13(14)17-12)8-3-2-4-9(8)19-11/h7,15H,2-6H2,1H3,(H2,14,16,17) |
| InChiKey: | InChIKey=WUSKTVHULHXVSO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.