* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VALEROYL CARNITINE |
| CAS: | 40225-14-7 |
| English Synonyms: | VALEROYL CARNITINE |
| MDL Number.: | MFCD18642167 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | CCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
| InChi: | InChI=1S/C12H23NO4/c1-5-6-7-12(16)17-10(8-11(14)15)9-13(2,3)4/h10H,5-9H2,1-4H3 |
| InChiKey: | InChIKey=VSNFQQXVMPSASB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.