* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-BENZOYL-8-AZABICYCLO[3.2.1]OCTAN-3-ONE |
CAS: | 1250831-56-1 |
English Synonyms: | 8-BENZOYL-8-AZABICYCLO[3.2.1]OCTAN-3-ONE |
MDL Number.: | MFCD18642748 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1ccc(cc1)C(=O)N2[C@H]3CC[C@@H]2CC(=O)C3 |
InChi: | InChI=1S/C14H15NO2/c16-13-8-11-6-7-12(9-13)15(11)14(17)10-4-2-1-3-5-10/h1-5,11-12H,6-9H2/t11-,12+ |
InChiKey: | InChIKey=OATQBSPRXZUSJZ-TXEJJXNPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.