* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-38005 |
| English Synonyms: | CHEMMAKER BCB-38005 |
| MDL Number.: | MFCD18752553 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2cc(cc(n2)C(C)(C)C(=O)OC)N |
| InChi: | InChI=1S/C16H25BN2O4/c1-14(2,13(20)21-7)11-8-10(18)9-12(19-11)17-22-15(3,4)16(5,6)23-17/h8-9H,1-7H3,(H2,18,19) |
| InChiKey: | InChIKey=IMMIFHKIYAEWFY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.