* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CHEMMAKER BCB-42357 |
English Synonyms: | CHEMMAKER BCB-42357 |
MDL Number.: | MFCD18753843 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | B1(OC(C(O1)(C)C)(C)C)c2cc(cc(n2)C)C3CCCNC3 |
InChi: | InChI=1S/C17H27BN2O2/c1-12-9-14(13-7-6-8-19-11-13)10-15(20-12)18-21-16(2,3)17(4,5)22-18/h9-10,13,19H,6-8,11H2,1-5H3 |
InChiKey: | InChIKey=YCIMMLNIGJJYCA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.