* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-43354 |
| English Synonyms: | CHEMMAKER BCB-43354 |
| MDL Number.: | MFCD18754101 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2cc(cc(n2)Cl)CC(C)(C)O |
| InChi: | InChI=1S/C15H23BClNO3/c1-13(2,19)9-10-7-11(18-12(17)8-10)16-20-14(3,4)15(5,6)21-16/h7-8,19H,9H2,1-6H3 |
| InChiKey: | InChIKey=SBICAYSIDHMZOE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.