* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-45950 |
| English Synonyms: | CHEMMAKER BCB-45950 |
| MDL Number.: | MFCD18755144 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2ccc(nc2C#N)CC3CCOCC3 |
| InChi: | InChI=1S/C18H25BN2O3/c1-17(2)18(3,4)24-19(23-17)15-6-5-14(21-16(15)12-20)11-13-7-9-22-10-8-13/h5-6,13H,7-11H2,1-4H3 |
| InChiKey: | InChIKey=SBJRIFMSKKHRPG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.