* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-46942 |
| English Synonyms: | CHEMMAKER BCB-46942 |
| MDL Number.: | MFCD18755632 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2cc(c(nc2)CCCC=C)OC |
| InChi: | InChI=1S/C17H26BNO3/c1-7-8-9-10-14-15(20-6)11-13(12-19-14)18-21-16(2,3)17(4,5)22-18/h7,11-12H,1,8-10H2,2-6H3 |
| InChiKey: | InChIKey=LZEAVDHTLYEZKR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.