* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-48362 |
| English Synonyms: | CHEMMAKER BCB-48362 |
| MDL Number.: | MFCD18756396 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2cc(ccn2)C3(CCC3)N.CO |
| InChi: | InChI=1S/C15H23BN2O2.CH4O/c1-13(2)14(3,4)20-16(19-13)12-10-11(6-9-18-12)15(17)7-5-8-15;1-2/h6,9-10H,5,7-8,17H2,1-4H3;2H,1H3 |
| InChiKey: | InChIKey=ZUUAAZNEOXLYBW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.