* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-48655 |
| English Synonyms: | CHEMMAKER BCB-48655 |
| MDL Number.: | MFCD18756655 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2c(c(ccn2)C3(CC(C3)F)N)C |
| InChi: | InChI=1S/C16H24BFN2O2/c1-10-12(16(19)8-11(18)9-16)6-7-20-13(10)17-21-14(2,3)15(4,5)22-17/h6-7,11H,8-9,19H2,1-5H3 |
| InChiKey: | InChIKey=AAADIHDNIHPKIS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.