* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CHEMMAKER BCB-56019 |
English Synonyms: | CHEMMAKER BCB-56019 |
MDL Number.: | MFCD18758723 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | B1(OC(C(O1)(C)C)(C)C)c2c(cccc2CC3CCCCO3)C |
InChi: | InChI=1S/C19H29BO3/c1-14-9-8-10-15(13-16-11-6-7-12-21-16)17(14)20-22-18(2,3)19(4,5)23-20/h8-10,16H,6-7,11-13H2,1-5H3 |
InChiKey: | InChIKey=SZXDFIYGLAHTPQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.