* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CHEMMAKER BCB-57515 |
English Synonyms: | CHEMMAKER BCB-57515 |
MDL Number.: | MFCD18759460 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | B1(OC(C(O1)(C)C)(C)C)c2c(cccc2Cl)CCC(C)N |
InChi: | InChI=1S/C16H25BClNO2/c1-11(19)9-10-12-7-6-8-13(18)14(12)17-20-15(2,3)16(4,5)21-17/h6-8,11H,9-10,19H2,1-5H3 |
InChiKey: | InChIKey=YEBJAPDNBBEXRS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.