* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-57531 |
| English Synonyms: | CHEMMAKER BCB-57531 |
| MDL Number.: | MFCD18759468 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2c(cccc2C(F)(F)F)CCC(C)N |
| InChi: | InChI=1S/C17H25BF3NO2/c1-11(22)9-10-12-7-6-8-13(17(19,20)21)14(12)18-23-15(2,3)16(4,5)24-18/h6-8,11H,9-10,22H2,1-5H3 |
| InChiKey: | InChIKey=ZUUJAVRSQHFLDU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.