* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-61386 |
| English Synonyms: | CHEMMAKER BCB-61386 |
| MDL Number.: | MFCD18760506 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2ccc(cc2C)CS(=O)(=O)N |
| InChi: | InChI=1S/C14H22BNO4S/c1-10-8-11(9-21(16,17)18)6-7-12(10)15-19-13(2,3)14(4,5)20-15/h6-8H,9H2,1-5H3,(H2,16,17,18) |
| InChiKey: | InChIKey=SAJWAROZZRIJOI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.