* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CHEMMAKER BCB-61695 |
English Synonyms: | CHEMMAKER BCB-61695 |
MDL Number.: | MFCD18760727 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | B1(OC(C(O1)(C)C)(C)C)c2ccc(c(c2)Cl)CCC(=O)C |
InChi: | InChI=1S/C16H22BClO3/c1-11(19)6-7-12-8-9-13(10-14(12)18)17-20-15(2,3)16(4,5)21-17/h8-10H,6-7H2,1-5H3 |
InChiKey: | InChIKey=ZZJUGWXYMNLJTQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.