* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CHEMMAKER BCB-61799 |
English Synonyms: | CHEMMAKER BCB-61799 |
MDL Number.: | MFCD18760742 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | B1(OC(C(O1)(C)C)(C)C)c2ccc(c(c2)Cl)CCCC=C |
InChi: | InChI=1S/C17H24BClO2/c1-6-7-8-9-13-10-11-14(12-15(13)19)18-20-16(2,3)17(4,5)21-18/h6,10-12H,1,7-9H2,2-5H3 |
InChiKey: | InChIKey=WSMJWOLJLPBUGX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.