* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-61807 |
| English Synonyms: | CHEMMAKER BCB-61807 |
| MDL Number.: | MFCD18760744 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2ccc(c(c2)OC)CCCC=C |
| InChi: | InChI=1S/C18H27BO3/c1-7-8-9-10-14-11-12-15(13-16(14)20-6)19-21-17(2,3)18(4,5)22-19/h7,11-13H,1,8-10H2,2-6H3 |
| InChiKey: | InChIKey=BOQCTOMLLXQMGQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.