* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-61849 |
| English Synonyms: | CHEMMAKER BCB-61849 |
| MDL Number.: | MFCD18760759 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2ccc(c(c2)F)CCC(C)(C)O |
| InChi: | InChI=1S/C17H26BFO3/c1-15(2,20)10-9-12-7-8-13(11-14(12)19)18-21-16(3,4)17(5,6)22-18/h7-8,11,20H,9-10H2,1-6H3 |
| InChiKey: | InChIKey=WOAWLQOKXBTZTR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.