* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CHEMMAKER BCB-62232 |
English Synonyms: | CHEMMAKER BCB-62232 |
MDL Number.: | MFCD18760986 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | B1(OC(C(O1)(C)C)(C)C)c2ccc(c(c2)C)C3(CC(C3)O)N |
InChi: | InChI=1S/C17H26BNO3/c1-11-8-12(18-21-15(2,3)16(4,5)22-18)6-7-14(11)17(19)9-13(20)10-17/h6-8,13,20H,9-10,19H2,1-5H3 |
InChiKey: | InChIKey=BHTLLOSAIMCZFX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.