* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-70795 |
| English Synonyms: | CHEMMAKER BCB-70795 |
| MDL Number.: | MFCD18761517 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2cnc(nc2)NC3CCCC3O |
| InChi: | InChI=1S/C15H24BN3O3/c1-14(2)15(3,4)22-16(21-14)10-8-17-13(18-9-10)19-11-6-5-7-12(11)20/h8-9,11-12,20H,5-7H2,1-4H3,(H,17,18,19) |
| InChiKey: | InChIKey=KHBUPRGAPVZOCF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.