* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-70805 |
| English Synonyms: | CHEMMAKER BCB-70805 |
| MDL Number.: | MFCD18761524 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2cncnc2N3CCC[C@H]3CO |
| InChi: | InChI=1S/C15H24BN3O3/c1-14(2)15(3,4)22-16(21-14)12-8-17-10-18-13(12)19-7-5-6-11(19)9-20/h8,10-11,20H,5-7,9H2,1-4H3/t11-/m0/s1 |
| InChiKey: | InChIKey=JUTFMPOXXGTTPP-NSHDSACASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.