* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-70806 |
| English Synonyms: | CHEMMAKER BCB-70806 |
| MDL Number.: | MFCD18761525 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2cccnc2N3CCC[C@H]3CO |
| InChi: | InChI=1S/C16H25BN2O3/c1-15(2)16(3,4)22-17(21-15)13-8-5-9-18-14(13)19-10-6-7-12(19)11-20/h5,8-9,12,20H,6-7,10-11H2,1-4H3/t12-/m0/s1 |
| InChiKey: | InChIKey=NXQUYPNAVDREBT-LBPRGKRZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.