* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CHEMMAKER BCB-71118 |
English Synonyms: | CHEMMAKER BCB-71118 |
MDL Number.: | MFCD18761751 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | B1(OC(C(O1)(C)C)(C)C)c2cccnc2N[C@@H](CO)C(C)C |
InChi: | InChI=1S/C16H27BN2O3/c1-11(2)13(10-20)19-14-12(8-7-9-18-14)17-21-15(3,4)16(5,6)22-17/h7-9,11,13,20H,10H2,1-6H3,(H,18,19)/t13-/m0/s1 |
InChiKey: | InChIKey=WGQCUVCTGSZUGT-ZDUSSCGKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.