* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CHEMMAKER BCB-71129 |
English Synonyms: | CHEMMAKER BCB-71129 |
MDL Number.: | MFCD18761762 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | B1(OC(C(O1)(C)C)(C)C)c2cncnc2NCCC(C)CO |
InChi: | InChI=1S/C15H26BN3O3/c1-11(9-20)6-7-18-13-12(8-17-10-19-13)16-21-14(2,3)15(4,5)22-16/h8,10-11,20H,6-7,9H2,1-5H3,(H,17,18,19) |
InChiKey: | InChIKey=WCCCIWLFTZMDEV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.