* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-71565 |
| English Synonyms: | CHEMMAKER BCB-71565 |
| MDL Number.: | MFCD18762297 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2ccnc(c2)N3C[C@@H](O[C@@H](C3)C)C |
| InChi: | InChI=1S/C17H27BN2O3/c1-12-10-20(11-13(2)21-12)15-9-14(7-8-19-15)18-22-16(3,4)17(5,6)23-18/h7-9,12-13H,10-11H2,1-6H3/t12-,13+ |
| InChiKey: | InChIKey=JHCIIILPXKRXMX-BETUJISGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.