* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-71568 |
| English Synonyms: | CHEMMAKER BCB-71568 |
| MDL Number.: | MFCD18762299 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2cccnc2N3CCC(CC3)CO |
| InChi: | InChI=1S/C17H27BN2O3/c1-16(2)17(3,4)23-18(22-16)14-6-5-9-19-15(14)20-10-7-13(12-21)8-11-20/h5-6,9,13,21H,7-8,10-12H2,1-4H3 |
| InChiKey: | InChIKey=QJTJSXWKWIYKHT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.