* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-72443 |
| English Synonyms: | CHEMMAKER BCB-72443 |
| MDL Number.: | MFCD18763012 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2cncnc2NCC3COC(O3)(C)C |
| InChi: | InChI=1S/C16H26BN3O4/c1-14(2)15(3,4)24-17(23-14)12-8-18-10-20-13(12)19-7-11-9-21-16(5,6)22-11/h8,10-11H,7,9H2,1-6H3,(H,18,19,20) |
| InChiKey: | InChIKey=QGHJOMMAHTUJNX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.