* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-73035 |
| English Synonyms: | CHEMMAKER BCB-73035 |
| MDL Number.: | MFCD18763497 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2ccnc(c2)N(C)CC(OCC)OCC |
| InChi: | InChI=1S/C18H31BN2O4/c1-8-22-16(23-9-2)13-21(7)15-12-14(10-11-20-15)19-24-17(3,4)18(5,6)25-19/h10-12,16H,8-9,13H2,1-7H3 |
| InChiKey: | InChIKey=AEABRZJASYMYMY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.