* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-73282 |
| English Synonyms: | CHEMMAKER BCB-73282 |
| MDL Number.: | MFCD18763732 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2ccc(nc2)N3CCC(CC3)(F)F.Cl |
| InChi: | InChI=1S/C16H23BF2N2O2.ClH/c1-14(2)15(3,4)23-17(22-14)12-5-6-13(20-11-12)21-9-7-16(18,19)8-10-21;/h5-6,11H,7-10H2,1-4H3;1H |
| InChiKey: | InChIKey=APZUJLHWVMVPPG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.