* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CHEMMAKER BCB-74084 |
English Synonyms: | CHEMMAKER BCB-74084 |
MDL Number.: | MFCD18764408 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | B1(OC(C(O1)(C)C)(C)C)c2cccc(n2)N3CCN(CC3)c4cc(cc(c4)Cl)Cl |
InChi: | InChI=1S/C21H26BCl2N3O2/c1-20(2)21(3,4)29-22(28-20)18-6-5-7-19(25-18)27-10-8-26(9-11-27)17-13-15(23)12-16(24)14-17/h5-7,12-14H,8-11H2,1-4H3 |
InChiKey: | InChIKey=QYPBSJLHJHOVBX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.