* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CHEMMAKER BCB-81880 |
English Synonyms: | CHEMMAKER BCB-81880 |
MDL Number.: | MFCD18765176 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | B1(OC(C(O1)(C)C)(C)C)c2cnc(cc2F)N(C)CC(C)C |
InChi: | InChI=1S/C16H26BFN2O2/c1-11(2)10-20(7)14-8-13(18)12(9-19-14)17-21-15(3,4)16(5,6)22-17/h8-9,11H,10H2,1-7H3 |
InChiKey: | InChIKey=FEEDLMDXMIGLIS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.