* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CHEMMAKER BCB-82485 |
English Synonyms: | CHEMMAKER BCB-82485 |
MDL Number.: | MFCD18765688 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | B1(OC(C(O1)(C)C)(C)C)c2c(ccnc2NCCC(C)O)C#N |
InChi: | InChI=1S/C16H24BN3O3/c1-11(21)6-8-19-14-13(12(10-18)7-9-20-14)17-22-15(2,3)16(4,5)23-17/h7,9,11,21H,6,8H2,1-5H3,(H,19,20) |
InChiKey: | InChIKey=PQWLNRWUKVBHMN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.