* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CHEMMAKER BCB-85101 |
English Synonyms: | CHEMMAKER BCB-85101 |
MDL Number.: | MFCD18767918 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | B1(OC(C(O1)(C)C)(C)C)c2ccc(c(n2)N3CC[C@H](C3)N(C)C)C |
InChi: | InChI=1S/C18H30BN3O2/c1-13-8-9-15(19-23-17(2,3)18(4,5)24-19)20-16(13)22-11-10-14(12-22)21(6)7/h8-9,14H,10-12H2,1-7H3/t14-/m1/s1 |
InChiKey: | InChIKey=LRQMYXJVPNALLS-CQSZACIVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.