* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CHEMMAKER BCB-85339 |
English Synonyms: | CHEMMAKER BCB-85339 |
MDL Number.: | MFCD18768066 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | B1(OC(C(O1)(C)C)(C)C)c2cc(ncc2C)N3CCC[C@@H]3C(=O)O |
InChi: | InChI=1S/C17H25BN2O4/c1-11-10-19-14(20-8-6-7-13(20)15(21)22)9-12(11)18-23-16(2,3)17(4,5)24-18/h9-10,13H,6-8H2,1-5H3,(H,21,22)/t13-/m1/s1 |
InChiKey: | InChIKey=XCFJKLFKSJKRTG-CYBMUJFWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.