* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-85398 |
| English Synonyms: | CHEMMAKER BCB-85398 |
| MDL Number.: | MFCD18768125 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2ccc(nc2C)N3CCC[C@H]3C(=O)O |
| InChi: | InChI=1S/C17H25BN2O4/c1-11-12(18-23-16(2,3)17(4,5)24-18)8-9-14(19-11)20-10-6-7-13(20)15(21)22/h8-9,13H,6-7,10H2,1-5H3,(H,21,22)/t13-/m0/s1 |
| InChiKey: | InChIKey=XQMPKRFLPSXMPQ-ZDUSSCGKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.